C20H21BBrNO4S — CID 172609522
1-(benzenesulfonyl)-5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 172609522) has the molecular formula C20H21BBrNO4S and a molecular weight of 462.17 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(benzenesulfonyl)-5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 172609522 |
| Molecular Formula | C20H21BBrNO4S |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 1-(benzenesulfonyl)-5-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2cc3cc(Br)ccc3n2S(=O)(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C20H21BBrNO4S/c1-19(2)20(3,4)27-21(26-19)18-13-14-12-15(22)10-11-17(14)23(18)28(24,25)16-8-6-5-7-9-16/h5-13H,1-4H3 |
| InChIKey | PIMAJAMCOUWCFJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|