C32H30BBrN4O2 — CID 161340109
5-bromo-1-phenylbenzimidazole;1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole (PubChem CID 161340109) has the molecular formula C32H30BBrN4O2 and a molecular weight of 593.33 g/mol. Its IUPAC name is 5-bromo-1-phenylbenzimidazole;1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole.
| Compound Name | 5-bromo-1-phenylbenzimidazole;1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 161340109 |
| Molecular Formula | C32H30BBrN4O2 |
| Molecular Weight | 593.33 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 5-bromo-1-phenylbenzimidazole;1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
| SMILES | Brc1ccc2c(c1)ncn2-c1ccccc1.CC1(C)OB(c2ccc3c(c2)ncn3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C19H21BN2O2.C13H9BrN2/c1-18(2)19(3,4)24-20(23-18)14-10-11-17-16(12-14)21-13-22(17)15-8-6-5-7-9-15;14-10-6-7-13-12(8-10)15-9-16(13)11-4-2-1-3-5-11/h5-13H,1-4H3;1-9H |
| InChIKey | VMNYUZAESGVHHT-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.33 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|