C14H14N4O4 — CID 172610414
4-(2-aminoethyl)-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione (PubChem CID 172610414) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione.
| Compound Name | 4-(2-aminoethyl)-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 172610414 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-(2-aminoethyl)-2-(2,4-dioxo-1,3-diazinan-1-yl)isoindole-1,3-dione |
| SMILES | NCCc1cccc2c1C(=O)N(N1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H14N4O4/c15-6-4-8-2-1-3-9-11(8)13(21)18(12(9)20)17-7-5-10(19)16-14(17)22/h1-3H,4-7,15H2,(H,16,19,22) |
| InChIKey | CGNWIWSFJPCPTO-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|