C15H16N4O4 — CID 166490093
4-amino-2-(2,4-dioxo-1,3-diazinan-1-yl)-6-propan-2-ylisoindole-1,3-dione (PubChem CID 166490093) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-amino-2-(2,4-dioxo-1,3-diazinan-1-yl)-6-propan-2-ylisoindole-1,3-dione.
| Compound Name | 4-amino-2-(2,4-dioxo-1,3-diazinan-1-yl)-6-propan-2-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 166490093 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-amino-2-(2,4-dioxo-1,3-diazinan-1-yl)-6-propan-2-ylisoindole-1,3-dione |
| SMILES | CC(C)c1cc(N)c2c(c1)C(=O)N(N1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H16N4O4/c1-7(2)8-5-9-12(10(16)6-8)14(22)19(13(9)21)18-4-3-11(20)17-15(18)23/h5-7H,3-4,16H2,1-2H3,(H,17,20,23) |
| InChIKey | KFWQPYTUYSYHEI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|