C17H26N4O2 — CID 177048685
ethane;1-[2-[methyl-(methylideneamino)amino]-4-propan-2-ylphenyl]-1,3-diazinane-2,4-dione (PubChem CID 177048685) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethane;1-[2-[methyl-(methylideneamino)amino]-4-propan-2-ylphenyl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[2-[methyl-(methylideneamino)amino]-4-propan-2-ylphenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177048685 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | ethane;1-[2-[methyl-(methylideneamino)amino]-4-propan-2-ylphenyl]-1,3-diazinane-2,4-dione |
| SMILES | C=NN(C)c1cc(C(C)C)ccc1N1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C15H20N4O2.C2H6/c1-10(2)11-5-6-12(13(9-11)18(4)16-3)19-8-7-14(20)17-15(19)21;1-2/h5-6,9-10H,3,7-8H2,1-2,4H3,(H,17,20,21);1-2H3 |
| InChIKey | XJYLXNFSWCUHKE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|