C18H26O2 — CID 172611463
4-deca-1,7-dienyl-2-ethoxyphenol (PubChem CID 172611463) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 4-deca-1,7-dienyl-2-ethoxyphenol.
| Compound Name | 4-deca-1,7-dienyl-2-ethoxyphenol |
|---|---|
| PubChem CID | 172611463 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4-deca-1,7-dienyl-2-ethoxyphenol |
| SMILES | CCC=CCCCCC=Cc1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C18H26O2/c1-3-5-6-7-8-9-10-11-12-16-13-14-17(19)18(15-16)20-4-2/h5-6,11-15,19H,3-4,7-10H2,1-2H3 |
| InChIKey | VEOFFBCQRKACRK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|