C13H13ClN4O2 — CID 172611534
4-[(2-chloro-4-pyridinyl)diazenyl]-3,5-dimethoxyaniline (PubChem CID 172611534) has the molecular formula C13H13ClN4O2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 4-[(2-chloro-4-pyridinyl)diazenyl]-3,5-dimethoxyaniline.
| Compound Name | 4-[(2-chloro-4-pyridinyl)diazenyl]-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 172611534 |
| Molecular Formula | C13H13ClN4O2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[(2-chloro-4-pyridinyl)diazenyl]-3,5-dimethoxyaniline |
| SMILES | COc1cc(N)cc(OC)c1/N=N/c1ccnc(Cl)c1 |
| InChI | InChI=1S/C13H13ClN4O2/c1-19-10-5-8(15)6-11(20-2)13(10)18-17-9-3-4-16-12(14)7-9/h3-7H,15H2,1-2H3/b18-17+ |
| InChIKey | HSAUMSSNNHSCNT-ISLYRVAYSA-N |
| XLogP | 3.75 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|