C14H14N6O2 — CID 58747536
4-(2H-benzotriazol-5-yldiazenyl)-3,5-dimethoxyaniline (PubChem CID 58747536) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-(2H-benzotriazol-5-yldiazenyl)-3,5-dimethoxyaniline.
| Compound Name | 4-(2H-benzotriazol-5-yldiazenyl)-3,5-dimethoxyaniline |
|---|---|
| PubChem CID | 58747536 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-(2H-benzotriazol-5-yldiazenyl)-3,5-dimethoxyaniline |
| SMILES | COc1cc(N)cc(OC)c1/N=N/c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C14H14N6O2/c1-21-12-5-8(15)6-13(22-2)14(12)19-16-9-3-4-10-11(7-9)18-20-17-10/h3-7H,15H2,1-2H3,(H,17,18,20)/b19-16+ |
| InChIKey | SNOVSECRCJKBFY-KNTRCKAVSA-N |
| XLogP | 2.97 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|