C17H21ClN2O3 — CID 172613918
tert-butyl 5-chloro-4-[methyl(prop-2-enoyl)amino]-1,3-dihydroisoindole-2-carboxylate (PubChem CID 172613918) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is tert-butyl 5-chloro-4-[methyl(prop-2-enoyl)amino]-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | tert-butyl 5-chloro-4-[methyl(prop-2-enoyl)amino]-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 172613918 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | tert-butyl 5-chloro-4-[methyl(prop-2-enoyl)amino]-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=CC(=O)N(C)c1c(Cl)ccc2c1CN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C17H21ClN2O3/c1-6-14(21)19(5)15-12-10-20(16(22)23-17(2,3)4)9-11(12)7-8-13(15)18/h6-8H,1,9-10H2,2-5H3 |
| InChIKey | RMWNXIDRCTYXPI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|