C19H28N6O — CID 172615707
N-[(3Z)-3-(cyclopropylhydrazinylidene)-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-8-yl]cyclopropanecarboxamide;ethane (PubChem CID 172615707) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(3Z)-3-(cyclopropylhydrazinylidene)-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-8-yl]cyclopropanecarboxamide;ethane.
| Compound Name | N-[(3Z)-3-(cyclopropylhydrazinylidene)-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-8-yl]cyclopropanecarboxamide;ethane |
|---|---|
| PubChem CID | 172615707 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[(3Z)-3-(cyclopropylhydrazinylidene)-4-imino-1,2-dimethyl-2H-1,7-naphthyridin-8-yl]cyclopropanecarboxamide;ethane |
| SMILES | CC.[H]/N=C1C(=N\NC2CC2)/C(C)N(C)c2c/1ccnc2NC(=O)C1CC1 |
| InChI | InChI=1S/C17H22N6O.C2H6/c1-9-14(22-21-11-5-6-11)13(18)12-7-8-19-16(15(12)23(9)2)20-17(24)10-3-4-10;1-2/h7-11,18,21H,3-6H2,1-2H3,(H,19,20,24);1-2H3/b18-13+,22-14-; |
| InChIKey | IDXIFRSMDBDEDV-XZGMTWHXSA-N |
| XLogP | 2.77 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|