C24H23F4N3O3 — CID 172617826
N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(1H-pyrazol-5-yl)phenyl]cyclohexane-1-carboxamide;formic acid (PubChem CID 172617826) has the molecular formula C24H23F4N3O3 and a molecular weight of 477.46 g/mol. Its IUPAC name is N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(1H-pyrazol-5-yl)phenyl]cyclohexane-1-carboxamide;formic acid.
| Compound Name | N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(1H-pyrazol-5-yl)phenyl]cyclohexane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 172617826 |
| Molecular Formula | C24H23F4N3O3 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(1H-pyrazol-5-yl)phenyl]cyclohexane-1-carboxamide;formic acid |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1F)C1CCCC(c2ccc(-c3ccn[nH]3)cc2)C1.O=CO |
| InChI | InChI=1S/C23H21F4N3O.CH2O2/c24-19-13-18(23(25,26)27)8-9-21(19)29-22(31)17-3-1-2-16(12-17)14-4-6-15(7-5-14)20-10-11-28-30-20;2-1-3/h4-11,13,16-17H,1-3,12H2,(H,28,30)(H,29,31);1H,(H,2,3) |
| InChIKey | QTKWOSPQSLWGFE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|