C25H26F4N2O2 — CID 172618458
N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(4-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 172618458) has the molecular formula C25H26F4N2O2 and a molecular weight of 462.49 g/mol. Its IUPAC name is N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(4-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(4-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 172618458 |
| Molecular Formula | C25H26F4N2O2 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-[2-fluoro-4-(trifluoromethyl)phenyl]-3-[4-(4-oxopiperidin-1-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | O=C1CCN(c2ccc(C3CCCC(C(=O)Nc4ccc(C(F)(F)F)cc4F)C3)cc2)CC1 |
| InChI | InChI=1S/C25H26F4N2O2/c26-22-15-19(25(27,28)29)6-9-23(22)30-24(33)18-3-1-2-17(14-18)16-4-7-20(8-5-16)31-12-10-21(32)11-13-31/h4-9,15,17-18H,1-3,10-14H2,(H,30,33) |
| InChIKey | WRAJLCOLVZTJRC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|