C25H26F4N6O3 — CID 172618739
3-[4-[(6Z)-1-amino-6-hydrazinylidenepyridazin-3-yl]phenyl]-N-[2-fluoro-4-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide;formic acid (PubChem CID 172618739) has the molecular formula C25H26F4N6O3 and a molecular weight of 534.51 g/mol. Its IUPAC name is 3-[4-[(6Z)-1-amino-6-hydrazinylidenepyridazin-3-yl]phenyl]-N-[2-fluoro-4-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide;formic acid.
| Compound Name | 3-[4-[(6Z)-1-amino-6-hydrazinylidenepyridazin-3-yl]phenyl]-N-[2-fluoro-4-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 172618739 |
| Molecular Formula | C25H26F4N6O3 |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 3-[4-[(6Z)-1-amino-6-hydrazinylidenepyridazin-3-yl]phenyl]-N-[2-fluoro-4-(trifluoromethyl)phenyl]cyclohexane-1-carboxamide;formic acid |
| SMILES | N/N=c1/ccc(-c2ccc(C3CCCC(C(=O)Nc4ccc(C(F)(F)F)cc4F)C3)cc2)nn1N.O=CO |
| InChI | InChI=1S/C24H24F4N6O.CH2O2/c25-19-13-18(24(26,27)28)8-9-21(19)31-23(35)17-3-1-2-16(12-17)14-4-6-15(7-5-14)20-10-11-22(32-29)34(30)33-20;2-1-3/h4-11,13,16-17H,1-3,12,29-30H2,(H,31,35);1H,(H,2,3)/b32-22-; |
| InChIKey | SBYVLWHAEQUTKQ-PXPBGKKLSA-N |
| XLogP | 3.81 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|