C22H19BrF4N2O3 — CID 172618199
(2R)-2-(4-bromo-3-cyanophenyl)cyclohexane-1-carboxylic acid;N-[2-fluoro-4-(trifluoromethyl)phenyl]formamide (PubChem CID 172618199) has the molecular formula C22H19BrF4N2O3 and a molecular weight of 515.30 g/mol. Its IUPAC name is (2R)-2-(4-bromo-3-cyanophenyl)cyclohexane-1-carboxylic acid;N-[2-fluoro-4-(trifluoromethyl)phenyl]formamide.
| Compound Name | (2R)-2-(4-bromo-3-cyanophenyl)cyclohexane-1-carboxylic acid;N-[2-fluoro-4-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 172618199 |
| Molecular Formula | C22H19BrF4N2O3 |
| Molecular Weight | 515.30 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | (2R)-2-(4-bromo-3-cyanophenyl)cyclohexane-1-carboxylic acid;N-[2-fluoro-4-(trifluoromethyl)phenyl]formamide |
| SMILES | N#Cc1cc([C@@H]2CCCCC2C(=O)O)ccc1Br.O=CNc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H14BrNO2.C8H5F4NO/c15-13-6-5-9(7-10(13)8-16)11-3-1-2-4-12(11)14(17)18;9-6-3-5(8(10,11)12)1-2-7(6)13-4-14/h5-7,11-12H,1-4H2,(H,17,18);1-4H,(H,13,14)/t11-,12?;/m0./s1 |
| InChIKey | DWAZMTYXQZFULU-YLIVSKOQSA-N |
| XLogP | 6.09 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.30 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|