About CID 172619482
CID 172619482 (PubChem CID 172619482) has the molecular formula C21H46N2OSi2
and a molecular weight of 398.78 g/mol.
Molecular Properties
| Compound Name | CID 172619482 |
| PubChem CID | 172619482 |
| Molecular Formula | C21H46N2OSi2 |
| Molecular Weight | 398.78 g/mol |
| Exact Mass | 398.31 |
| IUPAC Name | — |
| SMILES | CCN(CC)C([Si]CCCCCCCC[Si]OC(C)(C)C)N(CC)CC |
| InChI | InChI=1S/C21H46N2OSi2/c1-8-22(9-2)20(23(10-3)11-4)25-18-16-14-12-13-15-17-19-26-24-21(5,6)7/h20H,8-19H2,1-7H3 |
| InChIKey | YQBJSPGIMUJCQF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.78 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 172619482 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172619482?
The IUPAC name of CID 172619482 (CID 172619482) is not available.
What is the SMILES notation for CID 172619482?
The canonical SMILES for CID 172619482 is CCN(CC)C([Si]CCCCCCCC[Si]OC(C)(C)C)N(CC)CC.
What is the InChIKey of CID 172619482?
The InChIKey is YQBJSPGIMUJCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H46N2OSi2/c1-8-22(9-2)20(23(10-3)11-4)25-18-16-14-12-13-15-17-19-26-24-21(5,6)7/h20H,8-19H2,1-7H3.
What are the key properties of CID 172619482?
CID 172619482 has a molecular weight of 398.78 g/mol, XLogP of 5.27, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172619482 is sourced from PubChem (CID 172619482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).