C20H48N2O2Si4 — CID 172619330
CID 172619330 (PubChem CID 172619330) has the molecular formula C20H48N2O2Si4 and a molecular weight of 460.96 g/mol.
| Compound Name | CID 172619330 |
|---|---|
| PubChem CID | 172619330 |
| Molecular Formula | C20H48N2O2Si4 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | — |
| SMILES | CCN(CC)C([Si]CC[Si](C)(C)O[Si](C)(C)C(C)[Si]OC(C)C)N(CC)CC |
| InChI | InChI=1S/C20H48N2O2Si4/c1-12-21(13-2)20(22(14-3)15-4)25-16-17-27(8,9)24-28(10,11)19(7)26-23-18(5)6/h18-20H,12-17H2,1-11H3 |
| InChIKey | AMEHLVUFMWQQFK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|