C11H11N9 — CID 172619813
1-[(4-ethenylphenyl)methyl]-N-(2H-tetrazol-5-yl)tetrazol-5-amine (PubChem CID 172619813) has the molecular formula C11H11N9 and a molecular weight of 269.27 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methyl]-N-(2H-tetrazol-5-yl)tetrazol-5-amine.
| Compound Name | 1-[(4-ethenylphenyl)methyl]-N-(2H-tetrazol-5-yl)tetrazol-5-amine |
|---|---|
| PubChem CID | 172619813 |
| Molecular Formula | C11H11N9 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-[(4-ethenylphenyl)methyl]-N-(2H-tetrazol-5-yl)tetrazol-5-amine |
| SMILES | C=Cc1ccc(Cn2nnnc2Nc2nn[nH]n2)cc1 |
| InChI | InChI=1S/C11H11N9/c1-2-8-3-5-9(6-4-8)7-20-11(15-18-19-20)12-10-13-16-17-14-10/h2-6H,1,7H2,(H2,12,13,14,15,16,17,19) |
| InChIKey | IUKCESHFQXYRCZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |