C26H30N6O4 — CID 172620083
10-[[amino-[(Z)-2,5-diaminopent-1-enyl]amino]methyl]-19-hydroxy-6,7-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 172620083) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 10-[[amino-[(Z)-2,5-diaminopent-1-enyl]amino]methyl]-19-hydroxy-6,7-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 10-[[amino-[(Z)-2,5-diaminopent-1-enyl]amino]methyl]-19-hydroxy-6,7-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 172620083 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 10-[[amino-[(Z)-2,5-diaminopent-1-enyl]amino]methyl]-19-hydroxy-6,7-dimethyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | Cc1cc2nc3c(c(CN(N)/C=C(\N)CCCN)c2cc1C)Cn1c-3cc2c(c1=O)COC(=O)C2O |
| InChI | InChI=1S/C26H30N6O4/c1-13-6-16-18(10-31(29)9-15(28)4-3-5-27)19-11-32-22(23(19)30-21(16)7-14(13)2)8-17-20(25(32)34)12-36-26(35)24(17)33/h6-9,24,33H,3-5,10-12,27-29H2,1-2H3/b15-9- |
| InChIKey | ZTGYVAMZCHNVAR-DHDCSXOGSA-N |
| XLogP | 1.35 |
| TPSA | 162.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|