C29H27F3N3O+ — CID 172620796
4-(4-phenylcyclohexyl)-2-pyridin-1-ium-1-yl-5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidin-6-one (PubChem CID 172620796) has the molecular formula C29H27F3N3O+ and a molecular weight of 490.55 g/mol. Its IUPAC name is 4-(4-phenylcyclohexyl)-2-pyridin-1-ium-1-yl-5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 4-(4-phenylcyclohexyl)-2-pyridin-1-ium-1-yl-5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 172620796 |
| Molecular Formula | C29H27F3N3O+ |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 4-(4-phenylcyclohexyl)-2-pyridin-1-ium-1-yl-5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-[n+]2ccccc2)nc(C2CCC(c3ccccc3)CC2)c1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H26F3N3O/c30-29(31,32)24-11-7-8-20(18-24)19-25-26(33-28(34-27(25)36)35-16-5-2-6-17-35)23-14-12-22(13-15-23)21-9-3-1-4-10-21/h1-11,16-18,22-23H,12-15,19H2/p+1 |
| InChIKey | IGEQVZIJGWAAHD-UHFFFAOYSA-O |
| XLogP | 6.10 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|