C24H25F3N2OS — CID 141351279
6-(4-phenylcyclohexyl)-2-sulfanyl-5-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrimidin-4-one (PubChem CID 141351279) has the molecular formula C24H25F3N2OS and a molecular weight of 446.54 g/mol. Its IUPAC name is 6-(4-phenylcyclohexyl)-2-sulfanyl-5-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrimidin-4-one.
| Compound Name | 6-(4-phenylcyclohexyl)-2-sulfanyl-5-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 141351279 |
| Molecular Formula | C24H25F3N2OS |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 6-(4-phenylcyclohexyl)-2-sulfanyl-5-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydro-1H-pyrimidin-4-one |
| SMILES | O=C1NC(S)NC(C2CCC(c3ccccc3)CC2)=C1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N2OS/c25-24(26,27)19-8-4-5-15(13-19)14-20-21(28-23(31)29-22(20)30)18-11-9-17(10-12-18)16-6-2-1-3-7-16/h1-8,13,17-18,23,28,31H,9-12,14H2,(H,29,30) |
| InChIKey | CXVYGROKQMVSNC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|