C21H21ClFN5OS — CID 172620898
1-chloro-2-methoxybenzene;5-[2-fluoro-3-(methylsulfanylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 172620898) has the molecular formula C21H21ClFN5OS and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-chloro-2-methoxybenzene;5-[2-fluoro-3-(methylsulfanylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 1-chloro-2-methoxybenzene;5-[2-fluoro-3-(methylsulfanylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172620898 |
| Molecular Formula | C21H21ClFN5OS |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 1-chloro-2-methoxybenzene;5-[2-fluoro-3-(methylsulfanylamino)phenyl]-7-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccccc1Cl.CSNc1cccc(-c2cn(C)c3ncnc(N)c23)c1F |
| InChI | InChI=1S/C14H14FN5S.C7H7ClO/c1-20-6-9(11-13(16)17-7-18-14(11)20)8-4-3-5-10(12(8)15)19-21-2;1-9-7-5-3-2-4-6(7)8/h3-7,19H,1-2H3,(H2,16,17,18);2-5H,1H3 |
| InChIKey | SUKIQAULFOYTHY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|