C12H16N4 — CID 172623231
ethane;6-methyl-1,5-naphthyridine-2-carboximidamide (PubChem CID 172623231) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is ethane;6-methyl-1,5-naphthyridine-2-carboximidamide.
| Compound Name | ethane;6-methyl-1,5-naphthyridine-2-carboximidamide |
|---|---|
| PubChem CID | 172623231 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethane;6-methyl-1,5-naphthyridine-2-carboximidamide |
| SMILES | CC.[H]/N=C(\N)c1ccc2nc(C)ccc2n1 |
| InChI | InChI=1S/C10H10N4.C2H6/c1-6-2-3-8-7(13-6)4-5-9(14-8)10(11)12;1-2/h2-5H,1H3,(H3,11,12);1-2H3 |
| InChIKey | UNCGCKFWCGTNLN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|