C10H8Cl3N3 — CID 82248568
5,7-dichloroquinoline-2-carboximidamide;hydrochloride (PubChem CID 82248568) has the molecular formula C10H8Cl3N3 and a molecular weight of 276.55 g/mol. Its IUPAC name is 5,7-dichloroquinoline-2-carboximidamide;hydrochloride.
| Compound Name | 5,7-dichloroquinoline-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 82248568 |
| Molecular Formula | C10H8Cl3N3 |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 5,7-dichloroquinoline-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C10H7Cl2N3.ClH/c11-5-3-7(12)6-1-2-8(10(13)14)15-9(6)4-5;/h1-4H,(H3,13,14);1H |
| InChIKey | WAYRZFOPPSSPBZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|