C14H15Cl2N3 — CID 82449413
2-tert-butyl-6,8-dichloroquinoline-4-carboximidamide (PubChem CID 82449413) has the molecular formula C14H15Cl2N3 and a molecular weight of 296.20 g/mol. Its IUPAC name is 2-tert-butyl-6,8-dichloroquinoline-4-carboximidamide.
| Compound Name | 2-tert-butyl-6,8-dichloroquinoline-4-carboximidamide |
|---|---|
| PubChem CID | 82449413 |
| Molecular Formula | C14H15Cl2N3 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-tert-butyl-6,8-dichloroquinoline-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(C)(C)C)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C14H15Cl2N3/c1-14(2,3)11-6-9(13(17)18)8-4-7(15)5-10(16)12(8)19-11/h4-6H,1-3H3,(H3,17,18) |
| InChIKey | XCCLAUOGDAPPOK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|