C14H17F3N2S — CID 172624961
3,3,3-trifluoro-N-[2-(5-methylsulfanyl-1H-indol-3-yl)ethyl]propan-1-amine (PubChem CID 172624961) has the molecular formula C14H17F3N2S and a molecular weight of 302.37 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[2-(5-methylsulfanyl-1H-indol-3-yl)ethyl]propan-1-amine.
| Compound Name | 3,3,3-trifluoro-N-[2-(5-methylsulfanyl-1H-indol-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 172624961 |
| Molecular Formula | C14H17F3N2S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3,3,3-trifluoro-N-[2-(5-methylsulfanyl-1H-indol-3-yl)ethyl]propan-1-amine |
| SMILES | CSc1ccc2[nH]cc(CCNCCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C14H17F3N2S/c1-20-11-2-3-13-12(8-11)10(9-19-13)4-6-18-7-5-14(15,16)17/h2-3,8-9,18-19H,4-7H2,1H3 |
| InChIKey | LDVDPHNVNQRWDJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|