C17H23N7O — CID 172628825
4-amino-2-[3-amino-4-(propan-2-ylamino)anilino]-N-prop-2-enylpyrimidine-5-carboxamide (PubChem CID 172628825) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is 4-amino-2-[3-amino-4-(propan-2-ylamino)anilino]-N-prop-2-enylpyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-[3-amino-4-(propan-2-ylamino)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 172628825 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 4-amino-2-[3-amino-4-(propan-2-ylamino)anilino]-N-prop-2-enylpyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)c1cnc(Nc2ccc(NC(C)C)c(N)c2)nc1N |
| InChI | InChI=1S/C17H23N7O/c1-4-7-20-16(25)12-9-21-17(24-15(12)19)23-11-5-6-14(13(18)8-11)22-10(2)3/h4-6,8-10,22H,1,7,18H2,2-3H3,(H,20,25)(H3,19,21,23,24) |
| InChIKey | FESSHWUMSNQCCQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|