C24H25ClN8O — CID 172628882
6-(4-chloroanilino)-1-[6-[[(3S)-piperidin-3-yl]amino]-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 172628882) has the molecular formula C24H25ClN8O and a molecular weight of 476.97 g/mol. Its IUPAC name is 6-(4-chloroanilino)-1-[6-[[(3S)-piperidin-3-yl]amino]-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-(4-chloroanilino)-1-[6-[[(3S)-piperidin-3-yl]amino]-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 172628882 |
| Molecular Formula | C24H25ClN8O |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 6-(4-chloroanilino)-1-[6-[[(3S)-piperidin-3-yl]amino]-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(Cl)cc3)nc2n1-c1cccc(N[C@H]2CCCNC2)n1 |
| InChI | InChI=1S/C24H25ClN8O/c1-2-13-32-23(34)19-15-27-24(29-17-10-8-16(25)9-11-17)31-22(19)33(32)21-7-3-6-20(30-21)28-18-5-4-12-26-14-18/h2-3,6-11,15,18,26H,1,4-5,12-14H2,(H,28,30)(H,27,29,31)/t18-/m0/s1 |
| InChIKey | HMDIXDFZKKPWLV-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 101.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|