C24H25F2N9O — CID 134184739
1-(6-amino-2-pyridinyl)-6-[4-[3-(difluoromethyl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 134184739) has the molecular formula C24H25F2N9O and a molecular weight of 493.52 g/mol. Its IUPAC name is 1-(6-amino-2-pyridinyl)-6-[4-[3-(difluoromethyl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(6-amino-2-pyridinyl)-6-[4-[3-(difluoromethyl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 134184739 |
| Molecular Formula | C24H25F2N9O |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 1-(6-amino-2-pyridinyl)-6-[4-[3-(difluoromethyl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCNC(C(F)F)C4)cc3)nc2n1-c1cccc(N)n1 |
| InChI | InChI=1S/C24H25F2N9O/c1-2-11-34-23(36)17-13-29-24(32-22(17)35(34)20-5-3-4-19(27)31-20)30-15-6-8-16(9-7-15)33-12-10-28-18(14-33)21(25)26/h2-9,13,18,21,28H,1,10-12,14H2,(H2,27,31)(H,29,30,32) |
| InChIKey | GUENGYCABPJIHN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|