C24H25N3O4 — CID 172630846
methyl 1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-(2-methylphenoxy)piperidine-4-carboxylate (PubChem CID 172630846) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl 1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-(2-methylphenoxy)piperidine-4-carboxylate.
| Compound Name | methyl 1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-(2-methylphenoxy)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 172630846 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | methyl 1-[6-(2-hydroxyphenyl)pyridazin-4-yl]-4-(2-methylphenoxy)piperidine-4-carboxylate |
| SMILES | COC(=O)C1(Oc2ccccc2C)CCN(c2cnnc(-c3ccccc3O)c2)CC1 |
| InChI | InChI=1S/C24H25N3O4/c1-17-7-3-6-10-22(17)31-24(23(29)30-2)11-13-27(14-12-24)18-15-20(26-25-16-18)19-8-4-5-9-21(19)28/h3-10,15-16,28H,11-14H2,1-2H3 |
| InChIKey | BXSBFJUJEICWRQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |