C24H31N3O5 — CID 172630238
4-cyclohexyloxy-1-[6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperidine-4-carboxylic acid (PubChem CID 172630238) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-cyclohexyloxy-1-[6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 4-cyclohexyloxy-1-[6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 172630238 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 4-cyclohexyloxy-1-[6-[2-(methoxymethoxy)phenyl]pyridazin-4-yl]piperidine-4-carboxylic acid |
| SMILES | COCOc1ccccc1-c1cc(N2CCC(OC3CCCCC3)(C(=O)O)CC2)cnn1 |
| InChI | InChI=1S/C24H31N3O5/c1-30-17-31-22-10-6-5-9-20(22)21-15-18(16-25-26-21)27-13-11-24(12-14-27,23(28)29)32-19-7-3-2-4-8-19/h5-6,9-10,15-16,19H,2-4,7-8,11-14,17H2,1H3,(H,28,29) |
| InChIKey | ARIRVPPWIUUSKK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|