C20H22N2O2 — CID 167634404
3-[2-(methoxymethoxy)phenyl]-5-methyl-6,7,8,9-tetrahydro-5H-indeno[2,1-c]pyridazine (PubChem CID 167634404) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[2-(methoxymethoxy)phenyl]-5-methyl-6,7,8,9-tetrahydro-5H-indeno[2,1-c]pyridazine.
| Compound Name | 3-[2-(methoxymethoxy)phenyl]-5-methyl-6,7,8,9-tetrahydro-5H-indeno[2,1-c]pyridazine |
|---|---|
| PubChem CID | 167634404 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-[2-(methoxymethoxy)phenyl]-5-methyl-6,7,8,9-tetrahydro-5H-indeno[2,1-c]pyridazine |
| SMILES | COCOc1ccccc1-c1cc2c(nn1)CC1=C2C(C)CCC1 |
| InChI | InChI=1S/C20H22N2O2/c1-13-6-5-7-14-10-17-16(20(13)14)11-18(22-21-17)15-8-3-4-9-19(15)24-12-23-2/h3-4,8-9,11,13H,5-7,10,12H2,1-2H3 |
| InChIKey | YAOXIQONEUAGJX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|