C19H26FN5O2 — CID 172631120
(3Z,5Z)-4,6-diamino-5-[4-(4-fluoro-1-methylpiperidin-4-yl)-5-methoxy-2-pyridinyl]-2-methyliminohexa-3,5-dienal (PubChem CID 172631120) has the molecular formula C19H26FN5O2 and a molecular weight of 375.45 g/mol. Its IUPAC name is (3Z,5Z)-4,6-diamino-5-[4-(4-fluoro-1-methylpiperidin-4-yl)-5-methoxy-2-pyridinyl]-2-methyliminohexa-3,5-dienal.
| Compound Name | (3Z,5Z)-4,6-diamino-5-[4-(4-fluoro-1-methylpiperidin-4-yl)-5-methoxy-2-pyridinyl]-2-methyliminohexa-3,5-dienal |
|---|---|
| PubChem CID | 172631120 |
| Molecular Formula | C19H26FN5O2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | (3Z,5Z)-4,6-diamino-5-[4-(4-fluoro-1-methylpiperidin-4-yl)-5-methoxy-2-pyridinyl]-2-methyliminohexa-3,5-dienal |
| SMILES | C/N=C(C=O)/C=C(N)/C(=C/N)c1cc(C2(F)CCN(C)CC2)c(OC)cn1 |
| InChI | InChI=1S/C19H26FN5O2/c1-23-13(12-26)8-16(22)14(10-21)17-9-15(18(27-3)11-24-17)19(20)4-6-25(2)7-5-19/h8-12H,4-7,21-22H2,1-3H3/b14-10-,16-8-,23-13- |
| InChIKey | ZVFVLCFAUKYHLR-PSZQBNFZSA-N |
| XLogP | 1.39 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|