C17H18F2N4O3S — CID 172631976
[3-(6-amino-2,5-difluoro-3-pyridinyl)-6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl]methanol (PubChem CID 172631976) has the molecular formula C17H18F2N4O3S and a molecular weight of 396.42 g/mol. Its IUPAC name is [3-(6-amino-2,5-difluoro-3-pyridinyl)-6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl]methanol.
| Compound Name | [3-(6-amino-2,5-difluoro-3-pyridinyl)-6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 172631976 |
| Molecular Formula | C17H18F2N4O3S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [3-(6-amino-2,5-difluoro-3-pyridinyl)-6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl]methanol |
| SMILES | CC(C)(C)S(=O)(=O)c1cn2c(-c3cc(F)c(N)nc3F)cnc2cc1CO |
| InChI | InChI=1S/C17H18F2N4O3S/c1-17(2,3)27(25,26)13-7-23-12(6-21-14(23)4-9(13)8-24)10-5-11(18)16(20)22-15(10)19/h4-7,24H,8H2,1-3H3,(H2,20,22) |
| InChIKey | QWVPAOJOSDOWTL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|