C16H19ClF3N3O3S — CID 172634874
7-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-2-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane (PubChem CID 172634874) has the molecular formula C16H19ClF3N3O3S and a molecular weight of 425.86 g/mol. Its IUPAC name is 7-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-2-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 7-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-2-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 172634874 |
| Molecular Formula | C16H19ClF3N3O3S |
| Molecular Weight | 425.86 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 7-[[2-chloro-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-2-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1Cl)C1NCC12CN(C1CCOCC1)C2 |
| InChI | InChI=1S/C16H19ClF3N3O3S/c17-13-11(1-2-12(22-13)16(18,19)20)27(24,25)14-15(7-21-14)8-23(9-15)10-3-5-26-6-4-10/h1-2,10,14,21H,3-9H2 |
| InChIKey | LJYVILVPEAMTKB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.86 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|