C17H24F3N3O3S — CID 170144124
1-[[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine (PubChem CID 170144124) has the molecular formula C17H24F3N3O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-[[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 170144124 |
| Molecular Formula | C17H24F3N3O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[[2-ethyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
| SMILES | CCc1nc(C(F)(F)F)ccc1S(=O)(=O)N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C17H24F3N3O3S/c1-2-14-15(3-4-16(21-14)17(18,19)20)27(24,25)23-9-7-22(8-10-23)13-5-11-26-12-6-13/h3-4,13H,2,5-12H2,1H3 |
| InChIKey | BFTGFRCIUHOAMF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |