C18H24F3N3O3S — CID 170144096
1-[[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine (PubChem CID 170144096) has the molecular formula C18H24F3N3O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 1-[[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 170144096 |
| Molecular Formula | C18H24F3N3O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1C1CC1)N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C18H24F3N3O3S/c19-18(20,21)16-4-3-15(17(22-16)13-1-2-13)28(25,26)24-9-7-23(8-10-24)14-5-11-27-12-6-14/h3-4,13-14H,1-2,5-12H2 |
| InChIKey | QGTGZUJTZCDVDY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |