C16H25N3O4S — CID 170143993
1-[(6-methoxy-4-methyl-3-pyridinyl)sulfonyl]-4-(oxan-4-yl)piperazine (PubChem CID 170143993) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is 1-[(6-methoxy-4-methyl-3-pyridinyl)sulfonyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[(6-methoxy-4-methyl-3-pyridinyl)sulfonyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 170143993 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 1-[(6-methoxy-4-methyl-3-pyridinyl)sulfonyl]-4-(oxan-4-yl)piperazine |
| SMILES | COc1cc(C)c(S(=O)(=O)N2CCN(C3CCOCC3)CC2)cn1 |
| InChI | InChI=1S/C16H25N3O4S/c1-13-11-16(22-2)17-12-15(13)24(20,21)19-7-5-18(6-8-19)14-3-9-23-10-4-14/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | JARBPNRUKYMAQJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |