C18H25F2N3O3S — CID 169161271
1-[[2-cyclopropyl-6-(difluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine (PubChem CID 169161271) has the molecular formula C18H25F2N3O3S and a molecular weight of 401.48 g/mol. Its IUPAC name is 1-[[2-cyclopropyl-6-(difluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[[2-cyclopropyl-6-(difluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 169161271 |
| Molecular Formula | C18H25F2N3O3S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-[[2-cyclopropyl-6-(difluoromethyl)-3-pyridinyl]sulfonyl]-4-(oxan-4-yl)piperazine |
| SMILES | O=S(=O)(c1ccc(C(F)F)nc1C1CC1)N1CCN(C2CCOCC2)CC1 |
| InChI | InChI=1S/C18H25F2N3O3S/c19-18(20)15-3-4-16(17(21-15)13-1-2-13)27(24,25)23-9-7-22(8-10-23)14-5-11-26-12-6-14/h3-4,13-14,18H,1-2,5-12H2 |
| InChIKey | RSCZBZJIBXURGX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |