C17H15BrFNO — CID 172635510
3-[(2-bromo-5-methoxyphenyl)methyl]-5-fluoro-2-methyl-1H-indole (PubChem CID 172635510) has the molecular formula C17H15BrFNO and a molecular weight of 348.22 g/mol. Its IUPAC name is 3-[(2-bromo-5-methoxyphenyl)methyl]-5-fluoro-2-methyl-1H-indole.
| Compound Name | 3-[(2-bromo-5-methoxyphenyl)methyl]-5-fluoro-2-methyl-1H-indole |
|---|---|
| PubChem CID | 172635510 |
| Molecular Formula | C17H15BrFNO |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-[(2-bromo-5-methoxyphenyl)methyl]-5-fluoro-2-methyl-1H-indole |
| SMILES | COc1ccc(Br)c(Cc2c(C)[nH]c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C17H15BrFNO/c1-10-14(15-9-12(19)3-6-17(15)20-10)8-11-7-13(21-2)4-5-16(11)18/h3-7,9,20H,8H2,1-2H3 |
| InChIKey | HZIQYLXMGMHCFH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|