C21H23ClFN3OS — CID 17263604
3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-fluorophenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 17263604) has the molecular formula C21H23ClFN3OS and a molecular weight of 419.95 g/mol. Its IUPAC name is 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-fluorophenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-fluorophenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 17263604 |
| Molecular Formula | C21H23ClFN3OS |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-fluorophenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | CCn1c(CCCOc2ccc(Cl)cc2C)nnc1SCc1ccccc1F |
| InChI | InChI=1S/C21H23ClFN3OS/c1-3-26-20(9-6-12-27-19-11-10-17(22)13-15(19)2)24-25-21(26)28-14-16-7-4-5-8-18(16)23/h4-5,7-8,10-11,13H,3,6,9,12,14H2,1-2H3 |
| InChIKey | IUYIGAKKJGWPHO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|