C23H24ClN5O2S2 — CID 17265117
N-(1,3-benzothiazol-2-yl)-2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17265117) has the molecular formula C23H24ClN5O2S2 and a molecular weight of 502.07 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17265117 |
| Molecular Formula | C23H24ClN5O2S2 |
| Molecular Weight | 502.07 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[[5-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | CCn1c(CCCOc2ccc(Cl)cc2C)nnc1SCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H24ClN5O2S2/c1-3-29-20(9-6-12-31-18-11-10-16(24)13-15(18)2)27-28-23(29)32-14-21(30)26-22-25-17-7-4-5-8-19(17)33-22/h4-5,7-8,10-11,13H,3,6,9,12,14H2,1-2H3,(H,25,26,30) |
| InChIKey | RJSSIRPEODVNIA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.07 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|