C24H25Cl3N4O4S — CID 3630273
ethyl 4-chloro-3-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 3630273) has the molecular formula C24H25Cl3N4O4S and a molecular weight of 571.91 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-chloro-3-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 3630273 |
| Molecular Formula | C24H25Cl3N4O4S |
| Molecular Weight | 571.91 g/mol |
| Exact Mass | 570.07 |
| IUPAC Name | ethyl 4-chloro-3-[[2-[[5-[3-(2,4-dichlorophenoxy)propyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Cl)c(NC(=O)CSc2nnc(CCCOc3ccc(Cl)cc3Cl)n2CC)c1 |
| InChI | InChI=1S/C24H25Cl3N4O4S/c1-3-31-21(6-5-11-35-20-10-8-16(25)13-18(20)27)29-30-24(31)36-14-22(32)28-19-12-15(7-9-17(19)26)23(33)34-4-2/h7-10,12-13H,3-6,11,14H2,1-2H3,(H,28,32) |
| InChIKey | CRBCTMOFZOISPM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.91 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|