C22H26ClN3OS — CID 17302730
3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole (PubChem CID 17302730) has the molecular formula C22H26ClN3OS and a molecular weight of 415.99 g/mol. Its IUPAC name is 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 17302730 |
| Molecular Formula | C22H26ClN3OS |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-ethyl-5-[(2-methylphenyl)methylsulfanyl]-1,2,4-triazole |
| SMILES | CCn1c(CCCOc2ccc(Cl)cc2C)nnc1SCc1ccccc1C |
| InChI | InChI=1S/C22H26ClN3OS/c1-4-26-21(10-7-13-27-20-12-11-19(23)14-17(20)3)24-25-22(26)28-15-18-9-6-5-8-16(18)2/h5-6,8-9,11-12,14H,4,7,10,13,15H2,1-3H3 |
| InChIKey | ICUHZCGKVFTAFL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|