C21H23ClN4OS — CID 172640632
1-[4-[(6-chloro-1H-benzimidazol-2-yl)methoxy]phenyl]-3-cyclohexylthiourea (PubChem CID 172640632) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-[4-[(6-chloro-1H-benzimidazol-2-yl)methoxy]phenyl]-3-cyclohexylthiourea.
| Compound Name | 1-[4-[(6-chloro-1H-benzimidazol-2-yl)methoxy]phenyl]-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 172640632 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-[4-[(6-chloro-1H-benzimidazol-2-yl)methoxy]phenyl]-3-cyclohexylthiourea |
| SMILES | S=C(Nc1ccc(OCc2nc3ccc(Cl)cc3[nH]2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C21H23ClN4OS/c22-14-6-11-18-19(12-14)26-20(25-18)13-27-17-9-7-16(8-10-17)24-21(28)23-15-4-2-1-3-5-15/h6-12,15H,1-5,13H2,(H,25,26)(H2,23,24,28) |
| InChIKey | OXRFPLKSEXKATA-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|