C16H19N3O6S — CID 172641561
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-2-(1,3-thiazol-2-yldiazenyl)phenoxy]oxane-3,4,5-triol (PubChem CID 172641561) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-2-(1,3-thiazol-2-yldiazenyl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-2-(1,3-thiazol-2-yldiazenyl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 172641561 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-2-(1,3-thiazol-2-yldiazenyl)phenoxy]oxane-3,4,5-triol |
| SMILES | Cc1ccc(O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c(/N=N/c2nccs2)c1 |
| InChI | InChI=1S/C16H19N3O6S/c1-8-2-3-10(9(6-8)18-19-16-17-4-5-26-16)24-15-14(23)13(22)12(21)11(7-20)25-15/h2-6,11-15,20-23H,7H2,1H3/b19-18+/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | YSANFCQLJLFERN-AVSNBULKSA-N |
| XLogP | 1.05 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|