C24H21N5O3S — CID 172643756
N-[[[4-[(6-methyl-1H-benzimidazol-2-yl)methoxy]benzoyl]amino]carbamothioyl]benzamide (PubChem CID 172643756) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[[[4-[(6-methyl-1H-benzimidazol-2-yl)methoxy]benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | N-[[[4-[(6-methyl-1H-benzimidazol-2-yl)methoxy]benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 172643756 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-[[[4-[(6-methyl-1H-benzimidazol-2-yl)methoxy]benzoyl]amino]carbamothioyl]benzamide |
| SMILES | Cc1ccc2nc(COc3ccc(C(=O)NNC(=S)NC(=O)c4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C24H21N5O3S/c1-15-7-12-19-20(13-15)26-21(25-19)14-32-18-10-8-17(9-11-18)23(31)28-29-24(33)27-22(30)16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,25,26)(H,28,31)(H2,27,29,30,33) |
| InChIKey | KSNQLLKILLMAJA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|