C16H21BF3NO2 — CID 172644739
3-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine (PubChem CID 172644739) has the molecular formula C16H21BF3NO2 and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine.
| Compound Name | 3-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 172644739 |
| Molecular Formula | C16H21BF3NO2 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 3-cyclobutyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine |
| SMILES | CC1(C)OB(c2ccc(C3CCC3)c(C(F)(F)F)n2)OC1(C)C |
| InChI | InChI=1S/C16H21BF3NO2/c1-14(2)15(3,4)23-17(22-14)12-9-8-11(10-6-5-7-10)13(21-12)16(18,19)20/h8-10H,5-7H2,1-4H3 |
| InChIKey | WSYHESMDMJCPOG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|