C22H29BN2O5 — CID 140809504
4-cyclobutyl-2-(3,5-dimethoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-one (PubChem CID 140809504) has the molecular formula C22H29BN2O5 and a molecular weight of 412.30 g/mol. Its IUPAC name is 4-cyclobutyl-2-(3,5-dimethoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-one.
| Compound Name | 4-cyclobutyl-2-(3,5-dimethoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 140809504 |
| Molecular Formula | C22H29BN2O5 |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-cyclobutyl-2-(3,5-dimethoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridazin-3-one |
| SMILES | COc1cc(OC)cc(-n2nc(B3OC(C)(C)C(C)(C)O3)cc(C3CCC3)c2=O)c1 |
| InChI | InChI=1S/C22H29BN2O5/c1-21(2)22(3,4)30-23(29-21)19-13-18(14-8-7-9-14)20(26)25(24-19)15-10-16(27-5)12-17(11-15)28-6/h10-14H,7-9H2,1-6H3 |
| InChIKey | KJXCRACIHCABIU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|