C10H8F4N2O — CID 172647132
(4-amino-3,5-difluorophenyl)-(3,3-difluoroazetidin-1-yl)methanone (PubChem CID 172647132) has the molecular formula C10H8F4N2O and a molecular weight of 248.18 g/mol. Its IUPAC name is (4-amino-3,5-difluorophenyl)-(3,3-difluoroazetidin-1-yl)methanone.
| Compound Name | (4-amino-3,5-difluorophenyl)-(3,3-difluoroazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 172647132 |
| Molecular Formula | C10H8F4N2O |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (4-amino-3,5-difluorophenyl)-(3,3-difluoroazetidin-1-yl)methanone |
| SMILES | Nc1c(F)cc(C(=O)N2CC(F)(F)C2)cc1F |
| InChI | InChI=1S/C10H8F4N2O/c11-6-1-5(2-7(12)8(6)15)9(17)16-3-10(13,14)4-16/h1-2H,3-4,15H2 |
| InChIKey | QEIQXZKTGJFHTR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|