C10H10BrF2NO2 — CID 172648061
2-bromo-N-(2,2-difluoroethyl)-3-methoxybenzamide (PubChem CID 172648061) has the molecular formula C10H10BrF2NO2 and a molecular weight of 294.10 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoroethyl)-3-methoxybenzamide.
| Compound Name | 2-bromo-N-(2,2-difluoroethyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 172648061 |
| Molecular Formula | C10H10BrF2NO2 |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 2-bromo-N-(2,2-difluoroethyl)-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCC(F)F)c1Br |
| InChI | InChI=1S/C10H10BrF2NO2/c1-16-7-4-2-3-6(9(7)11)10(15)14-5-8(12)13/h2-4,8H,5H2,1H3,(H,14,15) |
| InChIKey | HNFMZZJSCGXUSX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |